Statistics
Total Visits
| Views | |
|---|---|
| An easily accessed class of recyclable hypervalent iodide reagents for functional group oxidations: bis(trifluoroacetate) adducts of fluorous alkyl iodides, CF3(CF2)(n-1)I(OCOCF3)(2) | 249 |
Total Visits Per Month
| October 2023 | November 2023 | December 2023 | January 2024 | February 2024 | March 2024 | April 2024 | |
|---|---|---|---|---|---|---|---|
| An easily accessed class of recyclable hypervalent iodide reagents for functional group oxidations: bis(trifluoroacetate) adducts of fluorous alkyl iodides, CF3(CF2)(n-1)I(OCOCF3)(2) | 0 | 1 | 12 | 1 | 1 | 1 | 4 |
File Visits
| Views |
|---|
Top country views
| Views | |
|---|---|
| United States | 122 |
| Sweden | 58 |
| Russia | 7 |
| Poland | 2 |
| Serbia | 2 |
| Singapore | 2 |
| Brazil | 1 |
| Spain | 1 |
| Italy | 1 |
| Netherlands | 1 |
Top cities views
| Views | |
|---|---|
| Ashburn | 106 |
| Belgrade | 2 |
| Warsaw | 2 |
| Arezzo | 1 |
| Des Moines | 1 |
| Madrid | 1 |
| Rio de Janeiro | 1 |
| San Mateo | 1 |